cas: 1219408-44-2 — see every product listed under this CAS number, including other names
methyl amino(2-bromophenyl)acetate hydrochloride, 97% (CAS 1219408-44-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F495636-500MG |
| cas | 1219408-44-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1695.25 Pln | |
| Fluorochem | 1g | 2497.06 Pln | |
| Fluorochem | 5g | 7339.10 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-amino-2-(2-bromophenyl)acetate;hydrochloride (CAS 1219408-44-2) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: methyl 2-amino-2-(2-bromophenyl)acetate;hydrochloride. InChIKey: YBWCLPWBSZSUQA-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | methyl 2-amino-2-(2-bromophenyl)acetate;hydrochloride |
| InChIKey | YBWCLPWBSZSUQA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1Br)N.Cl |
Computed by PubChem (NCBI)