CAS 1000334-03-1 is the registry number for 4-Bromo-7-methoxy-6-nitro-2,3-dihydro-1H-inden-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-7-methoxy-6-nitro-2,3-dihydroinden-1-one (CAS 1000334-03-1) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: 4-bromo-7-methoxy-6-nitro-2,3-dihydroinden-1-one. InChIKey: UXHSPIXXKKOPLF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO4 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | 4-bromo-7-methoxy-6-nitro-2,3-dihydroinden-1-one |
| InChIKey | UXHSPIXXKKOPLF-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1[N+](=O)[O-])Br)CCC2=O |
Computed by PubChem (NCBI)