CAS 2092040-62-3 is the registry number for Methyl 7-bromo-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 7-bromo-3-oxo-4H-1,4-benzoxazine-5-carboxylate (CAS 2092040-62-3) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: methyl 7-bromo-3-oxo-4H-1,4-benzoxazine-5-carboxylate. InChIKey: ZWHYBOKQYJERNT-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO4 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | methyl 7-bromo-3-oxo-4H-1,4-benzoxazine-5-carboxylate |
| InChIKey | ZWHYBOKQYJERNT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)Br)OCC(=O)N2 |
Computed by PubChem (NCBI)