Products 1803605-84-6

CAS 1803605-84-6 is the registry number for Ethyl 6-bromo-3-hydroxyfuro(3,2-b)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 6-bromo-3-hydroxyfuro[3,2-b]pyridine-2-carboxylate (CAS 1803605-84-6) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: ethyl 6-bromo-3-hydroxyfuro[3,2-b]pyridine-2-carboxylate. InChIKey: RSZKXMNAKZOMKM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrNO4
Molecular weight286.08 g/mol
IUPAC nameethyl 6-bromo-3-hydroxyfuro[3,2-b]pyridine-2-carboxylate
InChIKeyRSZKXMNAKZOMKM-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=C(O1)C=C(C=N2)Br)O

Computed by PubChem (NCBI)