CAS 13610-61-2 is the registry number for 3-(6-Bromo-2-oxo-1,3-benzoxazol-3(2h)-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (CAS 13610-61-2) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: 3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)propanoic acid. InChIKey: IAFZBVTUIXNIPJ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO4 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | 3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)propanoic acid |
| InChIKey | IAFZBVTUIXNIPJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=O)N2CCC(=O)O |
Computed by PubChem (NCBI)