Products 13610-61-2

CAS 13610-61-2 is the registry number for 3-(6-Bromo-2-oxo-1,3-benzoxazol-3(2h)-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)propanoic acid (CAS 13610-61-2) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: 3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)propanoic acid. InChIKey: IAFZBVTUIXNIPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrNO4
Molecular weight286.08 g/mol
IUPAC name3-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)propanoic acid
InChIKeyIAFZBVTUIXNIPJ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)OC(=O)N2CCC(=O)O

Computed by PubChem (NCBI)