CAS 833431-91-7 is the registry number for 3-Bromo-4-(cyanomethoxy)-5-methoxybenzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-bromo-4-(cyanomethoxy)-5-methoxybenzoic acid (CAS 833431-91-7) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: 3-bromo-4-(cyanomethoxy)-5-methoxybenzoic acid. InChIKey: LTLUCQIADVVLMU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO4 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | 3-bromo-4-(cyanomethoxy)-5-methoxybenzoic acid |
| InChIKey | LTLUCQIADVVLMU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C(=O)O)Br)OCC#N |
Computed by PubChem (NCBI)