CAS 2138166-16-0 is the registry number for 9-Bromo-5-oxo-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
9-bromo-5-oxo-3,4-dihydro-2H-1,4-benzoxazepine-7-carboxylic acid (CAS 2138166-16-0) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: 9-bromo-5-oxo-3,4-dihydro-2H-1,4-benzoxazepine-7-carboxylic acid. InChIKey: UHGGLIKPXDQJTP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO4 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | 9-bromo-5-oxo-3,4-dihydro-2H-1,4-benzoxazepine-7-carboxylic acid |
| InChIKey | UHGGLIKPXDQJTP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2Br)C(=O)O)C(=O)N1 |
Computed by PubChem (NCBI)