Products 1281513-01-6

CAS 1281513-01-6 is the registry number for 2-(6-Bromo-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl)acetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(6-bromo-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid (CAS 1281513-01-6) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: 2-(6-bromo-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid. InChIKey: JQONENRFKQXCPL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrNO4
Molecular weight286.08 g/mol
IUPAC name2-(6-bromo-3-oxo-4H-1,4-benzoxazin-2-yl)acetic acid
InChIKeyJQONENRFKQXCPL-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1Br)NC(=O)C(O2)CC(=O)O

Computed by PubChem (NCBI)