Products 2670397-46-1
CAS 2670397-46-1 is the registry number for Methyl 4-bromo-2-(2-nitrovinyl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-2-[(E)-2-nitroethenyl]benzoate (CAS 2670397-46-1) is a chemical compound with the molecular formula C10H8BrNO4 and a molecular weight of 286.08 g/mol. IUPAC name: methyl 4-bromo-2-[(E)-2-nitroethenyl]benzoate. InChIKey: PENMMURSIIYEPC-SNAWJCMRSA-N.
| Molecular formula | C10H8BrNO4 |
|---|---|
| Molecular weight | 286.08 g/mol |
| IUPAC name | methyl 4-bromo-2-[(E)-2-nitroethenyl]benzoate |
| InChIKey | PENMMURSIIYEPC-SNAWJCMRSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Br)/C=C/[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Methyl 4-bromo-2-(2-nitrovinyl)benzoate