CAS 1000932-30-8 is the registry number for 4-Chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde (CAS 1000932-30-8) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 4-chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde. InChIKey: MWDMJNZOVXEWSU-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 4-chloro-2-phenoxy-1,3-thiazole-5-carbaldehyde |
| InChIKey | MWDMJNZOVXEWSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC(=C(S2)C=O)Cl |
Computed by PubChem (NCBI)