CAS 1018520-26-7 is the registry number for 2-(2-Chlorophenyl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(2-chlorophenyl)-1,3-thiazole-5-carboxylic acid (CAS 1018520-26-7) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: CCUVOOGGOGDFOA-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | CCUVOOGGOGDFOA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)