CAS 24138-83-8 appears in our catalog under these names: 5-[(E)-(4-Chlorophenyl)methylidene]-1,3-thiazolane-2,4-dione, 95%, NSC 31152, NSC 31152/ 99.26% (existing batch purity), 5-(4-Chlorobenzylidene)thiazolidine-2,4-dione, 98%, 98%, Antimicrobial agent-30, 98.95%. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 100mg, 250mg, 25mg, 5mg, 1mg, 10mg.
5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 24138-83-8) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: OTTGINRZTJUWBT-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 5-[(4-chlorophenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | OTTGINRZTJUWBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C2C(=O)NC(=O)S2)Cl |
Computed by PubChem (NCBI)