CAS 17228-98-7 appears in our catalog under these names: 2-(4-Chlorophenyl)-1,3-thiazole-4-carboxylic acid, 98%, 2-(4-Chlorophenyl)thiazole-4-carboxylic acid 96%, 2-(4-Chlorophenyl)-1,3-thiazole-4-carboxylic acid, 96%, 96%, 2-(4-Chlorophenyl)-1,3-thiazole-4-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg.
2-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 17228-98-7) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: OOINMGFADWPJPC-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | OOINMGFADWPJPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)