CAS 878555-97-6 appears in our catalog under these names: 2-(3-Chlorophenyl)thiazole-5-carboxylicacid, 97%, 2-(3-Chlorophenyl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid (CAS 878555-97-6) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: GMTASVFGLFONMF-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | GMTASVFGLFONMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)