Products 944275-21-2
CAS 944275-21-2 appears in our catalog under these names: 2-(2-Chlorophenyl)-1,3-thiazole-4-carboxylic acid, 2-(2-Chlorophenyl)-1,3-thiazole-4-carboxylic acid, 96%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 10g, 25g, 5g, 1g.
2-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 944275-21-2) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: BWZOFJBZSUCPSM-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | BWZOFJBZSUCPSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=CS2)C(=O)O)Cl |
Computed by PubChem (NCBI)