CAS 1211505-13-3 is the registry number for 4-(2-Chlorophenyl)thiazole-2-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-(2-chlorophenyl)-1,3-thiazole-2-carboxylic acid (CAS 1211505-13-3) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 4-(2-chlorophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: MPIZWRKPEMRGSM-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | MPIZWRKPEMRGSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)