Products 845885-82-7
CAS 845885-82-7 appears in our catalog under these names: 2-(3-Chlorophenyl)thiazole-4-carboxylic acid, 2-(3-Chlorophenyl)-1,3-thiazole-4-carboxylic acid, 97% , 2-(3-Chlorophenyl)thiazole-4-carboxylic acid, 95%. Offered by: Biosynth, Thermo Scientific, Fluorochem. Available pack sizes: 2,5g, 250MG, 1g, 10g, 5g.
2-(3-chlorophenyl)-1,3-thiazole-4-carboxylic acid (CAS 845885-82-7) is a chemical compound with the molecular formula C10H6ClNO2S and a molecular weight of 239.68 g/mol. IUPAC name: 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: DNSCDQVZFMLMAD-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2S |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | DNSCDQVZFMLMAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)