Products 1001010-58-7
CAS 1001010-58-7 is the registry number for 5-(4-Fluoro-2-methylphenyl)furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(4-fluoro-2-methylphenyl)furan-2-carbaldehyde (CAS 1001010-58-7) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: 5-(4-fluoro-2-methylphenyl)furan-2-carbaldehyde. InChIKey: WHPBRMRCALRNKG-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | 5-(4-fluoro-2-methylphenyl)furan-2-carbaldehyde |
| InChIKey | WHPBRMRCALRNKG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)