Products 1718-17-8

CAS 1718-17-8 is the registry number for Methyl 3-fluoro-2-naphthoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-fluoronaphthalene-2-carboxylate (CAS 1718-17-8) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: methyl 3-fluoronaphthalene-2-carboxylate. InChIKey: CMHPMYBDWOALOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9FO2
Molecular weight204.20 g/mol
IUPAC namemethyl 3-fluoronaphthalene-2-carboxylate
InChIKeyCMHPMYBDWOALOJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC2=CC=CC=C2C=C1F

Computed by PubChem (NCBI)