CAS 1003048-74-5 appears in our catalog under these names: 7-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 96%, 96%, 7-Bromo-5-methoxy-2,3-dihydro-1H-inden-1-one, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g, 10g.
7-bromo-5-methoxy-2,3-dihydroinden-1-one (CAS 1003048-74-5) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-5-methoxy-2,3-dihydroinden-1-one. InChIKey: OZDYYVZUHUNFCS-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | OZDYYVZUHUNFCS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=O)CC2)C(=C1)Br |
Computed by PubChem (NCBI)