Products 1006295-05-1

CAS 1006295-05-1 is the registry number for methyl (2R)-2-(benzyloxycarbonylamino)-4,4-difluoro-butanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl (2R)-4,4-difluoro-2-(phenylmethoxycarbonylamino)butanoate (CAS 1006295-05-1) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: methyl (2R)-4,4-difluoro-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: HVDKCIFFBKRSLO-SNVBAGLBSA-N.

Identity
Molecular formulaC13H15F2NO4
Molecular weight287.26 g/mol
IUPAC namemethyl (2R)-4,4-difluoro-2-(phenylmethoxycarbonylamino)butanoate
InChIKeyHVDKCIFFBKRSLO-SNVBAGLBSA-N
SMILESCOC(=O)[C@@H](CC(F)F)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)