Products 2229480-86-6
CAS 2229480-86-6 is the registry number for 2-(2-((tert-Butoxycarbonyl)amino)phenyl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid (CAS 2229480-86-6) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: 2,2-difluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid. InChIKey: CEAPHPGFSKHTQC-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 2,2-difluoro-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid |
| InChIKey | CEAPHPGFSKHTQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC=C1C(C(=O)O)(F)F |
Computed by PubChem (NCBI)