Products 1344688-07-8
CAS 1344688-07-8 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}-2-(2,6-difluorophenyl)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(2,6-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1344688-07-8) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: FGWVGQFFGFJLGC-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | FGWVGQFFGFJLGC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=C(C=CC=C1F)F)C(=O)O |
Computed by PubChem (NCBI)