Products 1286792-97-9
CAS 1286792-97-9 is the registry number for Ethyl 4-amino-3-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
Ethyl 4-amino-3-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate (CAS 1286792-97-9) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: ethyl 4-amino-3-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate. InChIKey: YGNPXXKZRDJWRE-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | ethyl 4-amino-3-(2-ethoxy-1,1-difluoro-2-oxoethyl)benzoate |
| InChIKey | YGNPXXKZRDJWRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)N)C(C(=O)OCC)(F)F |
Computed by PubChem (NCBI)