CAS 1241677-76-8 appears in our catalog under these names: Boc-d-phg(3,5-f2)-oh, 95%, (R)–2–((tert–Butoxycarbonyl)amino)–2–(3,5–difluorophenyl)acetic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(2R)-2-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1241677-76-8) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: (2R)-2-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: RIPQDNQFPMQZRJ-SNVBAGLBSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | (2R)-2-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | RIPQDNQFPMQZRJ-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC(=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)