CAS 253324-75-3 appears in our catalog under these names: 2–((tert–Butoxycarbonyl)amino)–2–(3,5–difluorophenyl)acetic acid, 2-((tert-Butoxycarbonyl)amino)-2-(3,5-difluorophenyl)acetic acid, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 253324-75-3) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: RIPQDNQFPMQZRJ-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | RIPQDNQFPMQZRJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC(=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)