Products 2228368-99-6
CAS 2228368-99-6 appears in our catalog under these names: 2-(4-((tert-Butoxycarbonyl)amino)phenyl)-2,2-difluoroacetic acid, 96%, 96%, 2-(4-((tert-Butoxycarbonyl)amino)phenyl)-2,2-difluoroacetic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,2-difluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid (CAS 2228368-99-6) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: 2,2-difluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid. InChIKey: AMJYNAMFBJIXLP-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 2,2-difluoro-2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid |
| InChIKey | AMJYNAMFBJIXLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)