CAS 1436426-38-8 is the registry number for 4-(([(tert-Butoxy)carbonyl]amino)methyl)-2,3-difluorobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2,3-difluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid (CAS 1436426-38-8) is a chemical compound with the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. IUPAC name: 2,3-difluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid. InChIKey: AOBBSSWVACHQGE-UHFFFAOYSA-N.
| Molecular formula | C13H15F2NO4 |
|---|---|
| Molecular weight | 287.26 g/mol |
| IUPAC name | 2,3-difluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid |
| InChIKey | AOBBSSWVACHQGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C(=C(C=C1)C(=O)O)F)F |
Computed by PubChem (NCBI)