CAS 1006495-98-2 is the registry number for 1-Isopropyl-5-methyl-1H-pyrazole-4-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
5-methyl-1-propan-2-ylpyrazole-4-sulfonyl chloride (CAS 1006495-98-2) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 222.69 g/mol. IUPAC name: 5-methyl-1-propan-2-ylpyrazole-4-sulfonyl chloride. InChIKey: YFLLOAAKOQLXAO-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 222.69 g/mol |
| IUPAC name | 5-methyl-1-propan-2-ylpyrazole-4-sulfonyl chloride |
| InChIKey | YFLLOAAKOQLXAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C(C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)