CAS 1006876-25-0 appears in our catalog under these names: 1-(2-Chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid, 1-(2-Chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid, 96%, 96%, 1-(2-Chloro-6-fluorophenyl)cyclopropanecarboxylic acid, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 1g, 5g.
1-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 1006876-25-0) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: 1-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: BTMDJKGGDGZLIK-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | 1-(2-chloro-6-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | BTMDJKGGDGZLIK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=CC=C2Cl)F)C(=O)O |
Computed by PubChem (NCBI)