CAS 1008038-84-3 is the registry number for N-(2,4-Dichlorobenzoyl)-N-methyl-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(2,4-dichlorobenzoyl)amino]propanoate (CAS 1008038-84-3) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: methyl 2-[(2,4-dichlorobenzoyl)amino]propanoate. InChIKey: MVSKQXAOEFQJJO-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | methyl 2-[(2,4-dichlorobenzoyl)amino]propanoate |
| InChIKey | MVSKQXAOEFQJJO-UHFFFAOYSA-N |
| SMILES | CC(C(=O)OC)NC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)