Products 1152599-77-3
CAS 1152599-77-3 appears in our catalog under these names: 2-Butanamido-3,5-dichlorobenzoic acid, 95%, 2-Butanamido-3,5-dichlorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(butanoylamino)-3,5-dichlorobenzoic acid (CAS 1152599-77-3) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: 2-(butanoylamino)-3,5-dichlorobenzoic acid. InChIKey: NAELTMHMRVREIG-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 2-(butanoylamino)-3,5-dichlorobenzoic acid |
| InChIKey | NAELTMHMRVREIG-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)