Products 1099084-39-5
CAS 1099084-39-5 is the registry number for (3-(2,4-Dichlorophenyl)propanoyl)glycine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(2,4-dichlorophenyl)propanoylamino]acetic acid (CAS 1099084-39-5) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: 2-[3-(2,4-dichlorophenyl)propanoylamino]acetic acid. InChIKey: VGAVHQUYDKPQQQ-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 2-[3-(2,4-dichlorophenyl)propanoylamino]acetic acid |
| InChIKey | VGAVHQUYDKPQQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CCC(=O)NCC(=O)O |
Computed by PubChem (NCBI)