Products 53056-15-8

CAS 53056-15-8 is the registry number for 3-(2-(2,4-Dichlorophenyl)acetamido)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[[2-(2,4-dichlorophenyl)acetyl]amino]propanoic acid (CAS 53056-15-8) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: 3-[[2-(2,4-dichlorophenyl)acetyl]amino]propanoic acid. InChIKey: KLAWDYZFEQKJKG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11Cl2NO3
Molecular weight276.11 g/mol
IUPAC name3-[[2-(2,4-dichlorophenyl)acetyl]amino]propanoic acid
InChIKeyKLAWDYZFEQKJKG-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)CC(=O)NCCC(=O)O

Computed by PubChem (NCBI)