CAS 930395-68-9 is the registry number for 2-Chloro-N-(8-chloro-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetamide (CAS 930395-68-9) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: 2-chloro-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetamide. InChIKey: JGDWWKNQQXJVIA-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 2-chloro-N-(7-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)acetamide |
| InChIKey | JGDWWKNQQXJVIA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C2)NC(=O)CCl)Cl)OC1 |
Computed by PubChem (NCBI)