CAS 31110-41-5 is the registry number for 2-((3,5-Dichlorophenyl)formamido)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[(3,5-dichlorobenzoyl)amino]-2-methylpropanoic acid (CAS 31110-41-5) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: 2-[(3,5-dichlorobenzoyl)amino]-2-methylpropanoic acid. InChIKey: QKCTTYONJNFOSV-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | 2-[(3,5-dichlorobenzoyl)amino]-2-methylpropanoic acid |
| InChIKey | QKCTTYONJNFOSV-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC(=O)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)