Products 31110-41-5

CAS 31110-41-5 is the registry number for 2-((3,5-Dichlorophenyl)formamido)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[(3,5-dichlorobenzoyl)amino]-2-methylpropanoic acid (CAS 31110-41-5) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: 2-[(3,5-dichlorobenzoyl)amino]-2-methylpropanoic acid. InChIKey: QKCTTYONJNFOSV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11Cl2NO3
Molecular weight276.11 g/mol
IUPAC name2-[(3,5-dichlorobenzoyl)amino]-2-methylpropanoic acid
InChIKeyQKCTTYONJNFOSV-UHFFFAOYSA-N
SMILESCC(C)(C(=O)O)NC(=O)C1=CC(=CC(=C1)Cl)Cl

Computed by PubChem (NCBI)