Products 1313712-59-2
CAS 1313712-59-2 is the registry number for Chloro-acetic acid 2-(2-chloro-acetylamino)-benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-[(2-chloroacetyl)amino]phenyl]methyl 2-chloroacetate (CAS 1313712-59-2) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: [2-[(2-chloroacetyl)amino]phenyl]methyl 2-chloroacetate. InChIKey: AYZAZLKLYGPVKX-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | [2-[(2-chloroacetyl)amino]phenyl]methyl 2-chloroacetate |
| InChIKey | AYZAZLKLYGPVKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC(=O)CCl)NC(=O)CCl |
Computed by PubChem (NCBI)