Products 2055277-71-7
CAS 2055277-71-7 is the registry number for tert-Butyl 4,6-dichloro-5-formylnicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4,6-dichloro-5-formylpyridine-3-carboxylate (CAS 2055277-71-7) is a chemical compound with the molecular formula C11H11Cl2NO3 and a molecular weight of 276.11 g/mol. IUPAC name: tert-butyl 4,6-dichloro-5-formylpyridine-3-carboxylate. InChIKey: UZNHZXFKMIOUAE-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl2NO3 |
|---|---|
| Molecular weight | 276.11 g/mol |
| IUPAC name | tert-butyl 4,6-dichloro-5-formylpyridine-3-carboxylate |
| InChIKey | UZNHZXFKMIOUAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C(=C1Cl)C=O)Cl |
Computed by PubChem (NCBI)