CAS 1009735-22-1 appears in our catalog under these names: Methyl 2,6-dibromopyridine-3-carboxylate, 96%, Methyl 2,6-dibromonicotinate, 98%, METHYL 2,6-DIBROMOPYRIDINE-3-CARBOXYLATE, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
Methyl 2,6-dibromopyridine-3-carboxylate (CAS 1009735-22-1) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: methyl 2,6-dibromopyridine-3-carboxylate. InChIKey: RJHKFKXWRPVKRD-UHFFFAOYSA-N.
| Molecular formula | C7H5Br2NO2 |
|---|---|
| Molecular weight | 294.93 g/mol |
| IUPAC name | methyl 2,6-dibromopyridine-3-carboxylate |
| InChIKey | RJHKFKXWRPVKRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1)Br)Br |
Computed by PubChem (NCBI)