CAS 1013430-70-0 appears in our catalog under these names: ([3-(4-Pyridinyl)-1h-1,2,4-triazol-5-yl]methyl)amine dihydrochloride, 95%, {(3-(4-pyridinyl)-1H-1,2,4-triazol-5-yl)methyl}amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
(3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride (CAS 1013430-70-0) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: (3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride. InChIKey: IIDPGBKVXSDMJW-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | (3-pyridin-4-yl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride |
| InChIKey | IIDPGBKVXSDMJW-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NNC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)