Products 2138808-82-7
CAS 2138808-82-7 is the registry number for N-{((4-Amino-2-chlorophenyl)methylidene)amino}guanidine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(E)-(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride (CAS 2138808-82-7) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: 2-[(E)-(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride. InChIKey: WDCXQCKQQMBXFW-GAYQJXMFSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 2-[(E)-(4-amino-2-chlorophenyl)methylideneamino]guanidine;hydrochloride |
| InChIKey | WDCXQCKQQMBXFW-GAYQJXMFSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)/C=N/N=C(N)N.Cl |
Computed by PubChem (NCBI)