CAS 19579-44-3 appears in our catalog under these names: 1-(2-Chlorophenyl)biguanide hydrochloride, 95%, 1-(2-Chlorophenyl)biguanide, HCl, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g.
2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride (CAS 19579-44-3) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: 2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride. InChIKey: KWAQGQJGFPOSRH-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride |
| InChIKey | KWAQGQJGFPOSRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=C(N)N=C(N)N)Cl.Cl |
Computed by PubChem (NCBI)