Products 2113-05-5
CAS 2113-05-5 appears in our catalog under these names: 1–(3–Chlorophenyl)biguanide (hydrochloride), m–Chlorophenylbiguanide hydrochloride, 1-(3-Chlorophenyl)biguanide hydrochloride, 99%, 99%, m-CPBG (hydrochloride), 99.85%, m-CPBG (hydrochloride) (Standard). Offered by: GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g, 100mg, 250mg, 1 g, 100 mg.
2-(3-chlorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride (CAS 2113-05-5) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: 2-(3-chlorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride. InChIKey: FOWAIJYHRWFTHR-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-1-(diaminomethylidene)guanidine;hydrochloride |
| InChIKey | FOWAIJYHRWFTHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N=C(N)N=C(N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(3-Chlorophenyl)biguanide hydrochloride, N-m-Chlorophenylbiguanide hydrochloride, Imidodicarbonimidic diamide, N-(3-chlorophenyl)-, monohydrochloride, BIGUANIDE, 1-(m-CHLOROPHENYL)-, MONOHYDROCHLORIDE, m-chlorophenylbiguanide hydrochloride, m-Chlorophenylbiguanide HCl, 1-(m-Chlorophenyl)-biguanide hydrochloride, m-CPBG (hydrochloride), mCPBG (hydrochloride), m-CPBG hydrochloride