CAS 1794816-89-9 is the registry number for 1-(4-Chlorophenyl)biguanide-d4 Hydrochloride. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 2.5 mg, 25 mg.
2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-(diaminomethylidene)guanidine;hydrochloride (CAS 1794816-89-9) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 252.13 g/mol. IUPAC name: 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-(diaminomethylidene)guanidine;hydrochloride. InChIKey: NAFSLMFLGYXGIF-FOMJDCLLSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 252.13 g/mol |
| IUPAC name | 2-(4-chloro-2,3,5,6-tetradeuteriophenyl)-1-(diaminomethylidene)guanidine;hydrochloride |
| InChIKey | NAFSLMFLGYXGIF-FOMJDCLLSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N=C(N)N=C(N)N)[2H])[2H])Cl)[2H].Cl |
Computed by PubChem (NCBI)