Products 1258650-65-5
CAS 1258650-65-5 is the registry number for (3-(Pyridin-3-yl)-1H-1,2,4-triazol-5-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride (CAS 1258650-65-5) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: (3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride. InChIKey: GNEAQNCWZGEBCE-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | (3-pyridin-3-yl-1H-1,2,4-triazol-5-yl)methanamine;dihydrochloride |
| InChIKey | GNEAQNCWZGEBCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NNC(=N2)CN.Cl.Cl |
Computed by PubChem (NCBI)