CAS 2138054-15-4 appears in our catalog under these names: 4-[(1H-1.2.3.4-tetrazol-5-yl)methyl]aniline dihydrochloride, 95%, 4-((1H-1,2,3,4-Tetrazol-5-yl)methyl)aniline dihydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(2H-tetrazol-5-ylmethyl)aniline;dihydrochloride (CAS 2138054-15-4) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: 4-(2H-tetrazol-5-ylmethyl)aniline;dihydrochloride. InChIKey: BRDJXXYGLRURHY-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | 4-(2H-tetrazol-5-ylmethyl)aniline;dihydrochloride |
| InChIKey | BRDJXXYGLRURHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NNN=N2)N.Cl.Cl |
Computed by PubChem (NCBI)