CAS 2260931-60-8 is the registry number for Quinazoline-2,4,6-triamine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Quinazoline-2,4,6-triamine;dihydrochloride (CAS 2260931-60-8) is a chemical compound with the molecular formula C8H11Cl2N5 and a molecular weight of 248.11 g/mol. IUPAC name: quinazoline-2,4,6-triamine;dihydrochloride. InChIKey: BDUPMURJEKLVFI-UHFFFAOYSA-N.
| Molecular formula | C8H11Cl2N5 |
|---|---|
| Molecular weight | 248.11 g/mol |
| IUPAC name | quinazoline-2,4,6-triamine;dihydrochloride |
| InChIKey | BDUPMURJEKLVFI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=NC(=N2)N)N.Cl.Cl |
Computed by PubChem (NCBI)