Products 101460-85-9
CAS 101460-85-9 appears in our catalog under these names: Methyl 2,3-dioxoindoline-5-carboxylate 95%, 5-CARBOXYISATIN METHYL ESTER, 95%, 95%, Methyl 2,3-dioxoindoline-5-carboxylate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Methyl 2,3-dioxo-1H-indole-5-carboxylate (CAS 101460-85-9) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: methyl 2,3-dioxo-1H-indole-5-carboxylate. InChIKey: ATUFIXGDMRVWPE-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | methyl 2,3-dioxo-1H-indole-5-carboxylate |
| InChIKey | ATUFIXGDMRVWPE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NC(=O)C2=O |
Computed by PubChem (NCBI)