Products 10159-37-2
CAS 10159-37-2 is the registry number for 5-Hydroxytryptophol Sulfate. Offered by: TRC. Available pack sizes: 25mg.
[3-(2-hydroxyethyl)-1H-indol-5-yl] hydrogen sulfate (CAS 10159-37-2) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: [3-(2-hydroxyethyl)-1H-indol-5-yl] hydrogen sulfate. InChIKey: FOCUAJYUOXSNDS-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | [3-(2-hydroxyethyl)-1H-indol-5-yl] hydrogen sulfate |
| InChIKey | FOCUAJYUOXSNDS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OS(=O)(=O)O)C(=CN2)CCO |
Computed by PubChem (NCBI)