CAS 139123-66-3 is the registry number for 6-Amino-1-naphthol-3-sulfonic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g.
7-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate (CAS 139123-66-3) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 7-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate. InChIKey: ACNSFTVESQFFAE-UHFFFAOYSA-N.
| Molecular formula | C10H11NO5S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 7-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate |
| InChIKey | ACNSFTVESQFFAE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2C=C1N)S(=O)(=O)O)O.O |
Computed by PubChem (NCBI)