Products 139123-66-3

CAS 139123-66-3 is the registry number for 6-Amino-1-naphthol-3-sulfonic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g.

Structural formula: {0} (CAS {1})

7-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate (CAS 139123-66-3) is a chemical compound with the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. IUPAC name: 7-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate. InChIKey: ACNSFTVESQFFAE-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO5S
Molecular weight257.27 g/mol
IUPAC name7-amino-4-hydroxynaphthalene-2-sulfonic acid;hydrate
InChIKeyACNSFTVESQFFAE-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C(C=C2C=C1N)S(=O)(=O)O)O.O

Computed by PubChem (NCBI)